Describe a two step reaction route that can convert 1-Butene (CH2CHCH2CH3) into a compound that is more soluble in water. Use mechanisms to aid your answer (HINT: one of the steps involves nucleophilic substitution)

CH2CHCH2CH3 + HBr (room temp) --> CH3CH(Br)CH2CH3CH3CH(Br)CH2CH3 + NaOH (reflux) --> CH3CH(OH)CH2CH3Mechanism can be done on lesson spaceFinal product is more water soluble as the OH group will enable it to form hydrogen bonds with water

Related Chemistry A Level answers

All answers ▸

Describe, in three steps, how you would synthesise phenylethylamine (C6H5CH2CH2NH2) from methylbenzene, giving reagents and conditions for each step. For each step, state the type of reaction that occurs.


Explain why the first ionisation energy of Al is less than that of Mg?


How do acid buffer solutions work?


Why is phenylamine a weaker base than ethylamine?


We're here to help

contact us iconContact usWhatsapp logoMessage us on Whatsapptelephone icon+44 (0) 203 773 6020
Facebook logoInstagram logoLinkedIn logo

© MyTutorWeb Ltd 2013–2024

Terms & Conditions|Privacy Policy