Describe a two step reaction route that can convert 1-Butene (CH2CHCH2CH3) into a compound that is more soluble in water. Use mechanisms to aid your answer (HINT: one of the steps involves nucleophilic substitution)

CH2CHCH2CH3 + HBr (room temp) --> CH3CH(Br)CH2CH3CH3CH(Br)CH2CH3 + NaOH (reflux) --> CH3CH(OH)CH2CH3Mechanism can be done on lesson spaceFinal product is more water soluble as the OH group will enable it to form hydrogen bonds with water

SN
Answered by Sean N. Chemistry tutor

2057 Views

See similar Chemistry A Level tutors

Related Chemistry A Level answers

All answers ▸

What are the oxidation numbers of each element in these examples: a) H2SO4 b) N2 c) NH4+


explain why there is a decrease in first ionisation energy between elements phosphorus and sulfur


Explain the difference in reactivity between benzene and phenol with bromine?


Which test would you use to identify the difference between an aldehyde and a ketone? Explain your observations.


We're here to help

contact us iconContact ustelephone icon+44 (0) 203 773 6020
Facebook logoInstagram logoLinkedIn logo

MyTutor is part of the IXL family of brands:

© 2026 by IXL Learning