Describe a two step reaction route that can convert 1-Butene (CH2CHCH2CH3) into a compound that is more soluble in water. Use mechanisms to aid your answer (HINT: one of the steps involves nucleophilic substitution)

CH2CHCH2CH3 + HBr (room temp) --> CH3CH(Br)CH2CH3CH3CH(Br)CH2CH3 + NaOH (reflux) --> CH3CH(OH)CH2CH3Mechanism can be done on lesson spaceFinal product is more water soluble as the OH group will enable it to form hydrogen bonds with water

SN

Related Chemistry A Level answers

All answers ▸

Which chemical would have a higher boiling point 1,3-dimethylbutane or hexane


Can you explain the trend in ionisation energy across the periodic table?


An acid can be either strong or weak, explain the difference between strong and weak acids.


Explain the relative resistance to bromination of benzene compared to phenol and compared to cyclohexene.