Describe a two step reaction route that can convert 1-Butene (CH2CHCH2CH3) into a compound that is more soluble in water. Use mechanisms to aid your answer (HINT: one of the steps involves nucleophilic substitution)

CH2CHCH2CH3 + HBr (room temp) --> CH3CH(Br)CH2CH3CH3CH(Br)CH2CH3 + NaOH (reflux) --> CH3CH(OH)CH2CH3Mechanism can be done on lesson spaceFinal product is more water soluble as the OH group will enable it to form hydrogen bonds with water

SN
Answered by Sean N. Chemistry tutor

1841 Views

See similar Chemistry A Level tutors

Related Chemistry A Level answers

All answers ▸

Why does Phosphorus have a higher melting point than Chlorine?


The pH of pure water can vary depending on the temperature it is held at. Does that mean pure water can be acidic or alkaline?


What is hydrogen bonding and why does water have a higher boiling point than methanol?


The boiling points of ammonia (NH3), fluorine (F2) and bromine (Br2) are -33, -188 and +59 degrees celsius respectively. Explain the differences in these boiling points, including the names of any relevant forces and particles.


We're here to help

contact us iconContact ustelephone icon+44 (0) 203 773 6020
Facebook logoInstagram logoLinkedIn logo

MyTutor is part of the IXL family of brands:

© 2025 by IXL Learning