Describe a two step reaction route that can convert 1-Butene (CH2CHCH2CH3) into a compound that is more soluble in water. Use mechanisms to aid your answer (HINT: one of the steps involves nucleophilic substitution)

CH2CHCH2CH3 + HBr (room temp) --> CH3CH(Br)CH2CH3CH3CH(Br)CH2CH3 + NaOH (reflux) --> CH3CH(OH)CH2CH3Mechanism can be done on lesson spaceFinal product is more water soluble as the OH group will enable it to form hydrogen bonds with water

SN
Answered by Sean N. Chemistry tutor

1964 Views

See similar Chemistry A Level tutors

Related Chemistry A Level answers

All answers ▸

Write a balanced equation for the reaction between NaOH and sulfuric acid. A conical flask contains 25cm^3 of 0.124M NaOH, a burette contains 0.0625M sulfuric acid. Find the minimum amount of acid required to completely react with the NaOH in the flask.


I don't understand why carbon forms 4 bonds but nitrogen doesn't form 5.


What are buffers and how do they work?


Differences between Sn1 and Sn2 reactions


We're here to help

contact us iconContact ustelephone icon+44 (0) 203 773 6020
Facebook logoInstagram logoLinkedIn logo

MyTutor is part of the IXL family of brands:

© 2026 by IXL Learning