Describe a two step reaction route that can convert 1-Butene (CH2CHCH2CH3) into a compound that is more soluble in water. Use mechanisms to aid your answer (HINT: one of the steps involves nucleophilic substitution)
CH2CHCH2CH3 + HBr (room temp) --> CH3CH(Br)CH2CH3CH3CH(Br)CH2CH3 + NaOH (reflux) --> CH3CH(OH)CH2CH3Mechanism can be done on lesson spaceFinal product is more water soluble as the OH group will enable it to form hydrogen bonds with water
SN
Related Chemistry A Level answers
All answers ▸What does ‘aromatic’ mean?
explain why there is a decrease in first ionisation energy between elements phosphorus and sulfur
What is relative molecular mass (RMM) and why use carbon-12?
Acid HA has a Ka of 2.00 x 10-4mol dm-3. A solution was made by adding 15cm3 of 0.34 M NaOH to 25cm3 of 0.45M HA. Calculate the moles and the concentration of A- and HA in this solution. Using the expression for Ka calculate the pH of the solution