Describe a two step reaction route that can convert 1-Butene (CH2CHCH2CH3) into a compound that is more soluble in water. Use mechanisms to aid your answer (HINT: one of the steps involves nucleophilic substitution)

CH2CHCH2CH3 + HBr (room temp) --> CH3CH(Br)CH2CH3CH3CH(Br)CH2CH3 + NaOH (reflux) --> CH3CH(OH)CH2CH3Mechanism can be done on lesson spaceFinal product is more water soluble as the OH group will enable it to form hydrogen bonds with water

SN

Related Chemistry A Level answers

All answers ▸

Draw a dot-cross diagram of Chlorine Triflouride, and discuss the shape exhibited by the molecule


Can you explain Le Chatelier's Principle?


Order the following in terms of boiling point and explain your reasoning: Ethanol, Ethane, Propane


What is a stereoisomer?