Describe a two step reaction route that can convert 1-Butene (CH2CHCH2CH3) into a compound that is more soluble in water. Use mechanisms to aid your answer (HINT: one of the steps involves nucleophilic substitution)

CH2CHCH2CH3 + HBr (room temp) --> CH3CH(Br)CH2CH3CH3CH(Br)CH2CH3 + NaOH (reflux) --> CH3CH(OH)CH2CH3Mechanism can be done on lesson spaceFinal product is more water soluble as the OH group will enable it to form hydrogen bonds with water

SN
Answered by Sean N. Chemistry tutor

1942 Views

See similar Chemistry A Level tutors

Related Chemistry A Level answers

All answers ▸

Why does ionisation energy increase across Period 3?


Why does ionisation energy of elements generally decrease as you move down a group in the periodic table?


State and explain the tests necessary to positively identify an unknown sample as copper carbonate


What is the difference between pH and pKa?


We're here to help

contact us iconContact ustelephone icon+44 (0) 203 773 6020
Facebook logoInstagram logoLinkedIn logo

MyTutor is part of the IXL family of brands:

© 2026 by IXL Learning