Describe a two step reaction route that can convert 1-Butene (CH2CHCH2CH3) into a compound that is more soluble in water. Use mechanisms to aid your answer (HINT: one of the steps involves nucleophilic substitution)

CH2CHCH2CH3 + HBr (room temp) --> CH3CH(Br)CH2CH3CH3CH(Br)CH2CH3 + NaOH (reflux) --> CH3CH(OH)CH2CH3Mechanism can be done on lesson spaceFinal product is more water soluble as the OH group will enable it to form hydrogen bonds with water

SN
Answered by Sean N. Chemistry tutor

1809 Views

See similar Chemistry A Level tutors

Related Chemistry A Level answers

All answers ▸

Name and Outline a mechanism for the formation of methylpropanoate from methanol and propanoyl chloride.


What is chirality? Why is it seen in amino acids?


Lead (IV) oxide reacts with concentrated hydrochloric acid as follows: PbO2(s) + 4HCl(aq) -----> PbCl2(s) + Cl2(g) + 2H2O(l) What mass of lead chloride would be obtained from 37.2g of PbO2, and what mass of chlorine gas would be produced


Calculate the mass of sodium amide needed to obtain 550 g of sodium azide, assuming there is a 95.0% yield of sodium azide. Give your answer to 3 significant figures.


We're here to help

contact us iconContact ustelephone icon+44 (0) 203 773 6020
Facebook logoInstagram logoLinkedIn logo

MyTutor is part of the IXL family of brands:

© 2025 by IXL Learning