Describe a two step reaction route that can convert 1-Butene (CH2CHCH2CH3) into a compound that is more soluble in water. Use mechanisms to aid your answer (HINT: one of the steps involves nucleophilic substitution)

CH2CHCH2CH3 + HBr (room temp) --> CH3CH(Br)CH2CH3CH3CH(Br)CH2CH3 + NaOH (reflux) --> CH3CH(OH)CH2CH3Mechanism can be done on lesson spaceFinal product is more water soluble as the OH group will enable it to form hydrogen bonds with water

SN
Answered by Sean N. Chemistry tutor

2049 Views

See similar Chemistry A Level tutors

Related Chemistry A Level answers

All answers ▸

Why does bromine water become colourless upon the addition of ethene, but not ethane? What is this reaction called?


In the presence of ultraviolet radiation, cyclohexane reacts with bromine. A mixture of cyclic products are formed, including C6H11Br. Discuss each step of this reaction providing equations to show the mechanism.


Imagine a reaction A for which the values of ΔH and ΔS are both negative. It is known that the absolute value of ΔS is 3 times smaller than the absolute value of ΔH. For what values of T does reaction A occur spontaneously?


What's the difference between Aliphatic and Aromatic Molecules?


We're here to help

contact us iconContact ustelephone icon+44 (0) 203 773 6020
Facebook logoInstagram logoLinkedIn logo

MyTutor is part of the IXL family of brands:

© 2026 by IXL Learning