Describe a two step reaction route that can convert 1-Butene (CH2CHCH2CH3) into a compound that is more soluble in water. Use mechanisms to aid your answer (HINT: one of the steps involves nucleophilic substitution)

CH2CHCH2CH3 + HBr (room temp) --> CH3CH(Br)CH2CH3CH3CH(Br)CH2CH3 + NaOH (reflux) --> CH3CH(OH)CH2CH3Mechanism can be done on lesson spaceFinal product is more water soluble as the OH group will enable it to form hydrogen bonds with water

SN
Answered by Sean N. Chemistry tutor

2036 Views

See similar Chemistry A Level tutors

Related Chemistry A Level answers

All answers ▸

Why do the atomic radii of the elements decrease across a period on the periodic table.


State why it is initially unexpected for alkenes to undergo electrophilic addition with bromine. Explain why this reaction does indeed occur.


Calculate the pH of the solution formed when 30 cm3 of 0.150 moldm-3 aqueous sulfuric acid is added to 30 cm3 of 0.200 moldm-3 aqueous potassium hydroxide at 25 C.


What is a radical?


We're here to help

contact us iconContact ustelephone icon+44 (0) 203 773 6020
Facebook logoInstagram logoLinkedIn logo

MyTutor is part of the IXL family of brands:

© 2026 by IXL Learning