Describe a two step reaction route that can convert 1-Butene (CH2CHCH2CH3) into a compound that is more soluble in water. Use mechanisms to aid your answer (HINT: one of the steps involves nucleophilic substitution)

CH2CHCH2CH3 + HBr (room temp) --> CH3CH(Br)CH2CH3CH3CH(Br)CH2CH3 + NaOH (reflux) --> CH3CH(OH)CH2CH3Mechanism can be done on lesson spaceFinal product is more water soluble as the OH group will enable it to form hydrogen bonds with water

SN
Answered by Sean N. Chemistry tutor

2193 Views

See similar Chemistry A Level tutors

Related Chemistry A Level answers

All answers ▸

Deduce which of Na+ and Mg2+ is the smaller ion. Explain your answer.


What is the difference between stereoisomerism and optical isomerism?


Why do the atomic radii of the elements decrease across Period 3 from sodium to chlorine?


Draw the shape of an SF6 and SF4 molecule, indicating bond angles and any lone pairs which may influence these. What shape is the SF6 molecule?


We're here to help

contact us iconContact ustelephone icon+44 (0) 203 773 6020
Facebook logoInstagram logoLinkedIn logo

MyTutor is part of the IXL family of brands:

© 2026 by IXL Learning