Describe a two step reaction route that can convert 1-Butene (CH2CHCH2CH3) into a compound that is more soluble in water. Use mechanisms to aid your answer (HINT: one of the steps involves nucleophilic substitution)

CH2CHCH2CH3 + HBr (room temp) --> CH3CH(Br)CH2CH3CH3CH(Br)CH2CH3 + NaOH (reflux) --> CH3CH(OH)CH2CH3Mechanism can be done on lesson spaceFinal product is more water soluble as the OH group will enable it to form hydrogen bonds with water

SN
Answered by Sean N. Chemistry tutor

1947 Views

See similar Chemistry A Level tutors

Related Chemistry A Level answers

All answers ▸

Differences between Sn1 and Sn2 reactions


How can crude oil be used as a source of hydrocarbons?


Why does the bromine become polarised in HBr during electrophilic addition


The Aldehyde CH3CH2CHO (A) reacts with HCN to give a racemic mixture, name the compound CH3CH2CH(CN)OH (B) formed and explain why we get a racemic mixture and how we could differentiate between two different enantiomerically pure solutions of B


We're here to help

contact us iconContact ustelephone icon+44 (0) 203 773 6020
Facebook logoInstagram logoLinkedIn logo

MyTutor is part of the IXL family of brands:

© 2026 by IXL Learning