Describe a two step reaction route that can convert 1-Butene (CH2CHCH2CH3) into a compound that is more soluble in water. Use mechanisms to aid your answer (HINT: one of the steps involves nucleophilic substitution)

CH2CHCH2CH3 + HBr (room temp) --> CH3CH(Br)CH2CH3CH3CH(Br)CH2CH3 + NaOH (reflux) --> CH3CH(OH)CH2CH3Mechanism can be done on lesson spaceFinal product is more water soluble as the OH group will enable it to form hydrogen bonds with water

SN
Answered by Sean N. Chemistry tutor

1996 Views

See similar Chemistry A Level tutors

Related Chemistry A Level answers

All answers ▸

Define enthalpy of neutralisation and state standard conditions:


Compare the structures of Diamond and Graphite, making references to the bonding, the shape of the structures, and location of the electrons within the structures. Account for the fact that graphite conducts electricity and diamond does not.


Why does Phosphorus have a higher melting point than Chlorine?


Why is benzene more stable than the theoretical model cyclohexa-1,3,5-triene?


We're here to help

contact us iconContact ustelephone icon+44 (0) 203 773 6020
Facebook logoInstagram logoLinkedIn logo

MyTutor is part of the IXL family of brands:

© 2026 by IXL Learning