Describe a two step reaction route that can convert 1-Butene (CH2CHCH2CH3) into a compound that is more soluble in water. Use mechanisms to aid your answer (HINT: one of the steps involves nucleophilic substitution)

CH2CHCH2CH3 + HBr (room temp) --> CH3CH(Br)CH2CH3CH3CH(Br)CH2CH3 + NaOH (reflux) --> CH3CH(OH)CH2CH3Mechanism can be done on lesson spaceFinal product is more water soluble as the OH group will enable it to form hydrogen bonds with water

SN

Related Chemistry A Level answers

All answers ▸

Chlorine, 15 g, is contained in a vessel with a volume of 0.80 dm3 at 330 K. Calculate the pressure exerted when the chlorine is treated as a perfect (ideal) gas giving your answer in terms of kPa


3.786g of hydrated zinc sulphate, ZnSO4•xH2O, is heated to remove all water of crystallisation. The mass of anhydrous ZnSO4 formed is 2.122g. What is the formula of the hydrated zinc sulphate?


Describe how you test for an aldehyde or ketone and distinguish between the two.


What is the pH of 0.10 mol.dm^(-3) sodium hydroxide solution, NaOH?