Describe a two step reaction route that can convert 1-Butene (CH2CHCH2CH3) into a compound that is more soluble in water. Use mechanisms to aid your answer (HINT: one of the steps involves nucleophilic substitution)

CH2CHCH2CH3 + HBr (room temp) --> CH3CH(Br)CH2CH3CH3CH(Br)CH2CH3 + NaOH (reflux) --> CH3CH(OH)CH2CH3Mechanism can be done on lesson spaceFinal product is more water soluble as the OH group will enable it to form hydrogen bonds with water

SN

Related Chemistry A Level answers

All answers ▸

How does the ionisation energy differ across period 2 from Li to Ne?


What is the difference between a nucleophile and an electrophile?


The Haber process is used to manufacture ammonia. Explain the optimum conditions for this reaction and why these conditions may not be used in industry


Explain the bonding in and the shape of a benzene molecule.