Describe a two step reaction route that can convert 1-Butene (CH2CHCH2CH3) into a compound that is more soluble in water. Use mechanisms to aid your answer (HINT: one of the steps involves nucleophilic substitution)

CH2CHCH2CH3 + HBr (room temp) --> CH3CH(Br)CH2CH3CH3CH(Br)CH2CH3 + NaOH (reflux) --> CH3CH(OH)CH2CH3Mechanism can be done on lesson spaceFinal product is more water soluble as the OH group will enable it to form hydrogen bonds with water

SN
Answered by Sean N. Chemistry tutor

1860 Views

See similar Chemistry A Level tutors

Related Chemistry A Level answers

All answers ▸

Why is benzene more stable than expected?


How do you convert between different SI units, for example, nmol to mmol?


How to we increase the rate of a reaction?


What is the difference between a Bronsted Lowry acid and a Lewis Acid?


We're here to help

contact us iconContact ustelephone icon+44 (0) 203 773 6020
Facebook logoInstagram logoLinkedIn logo

MyTutor is part of the IXL family of brands:

© 2026 by IXL Learning