Describe a two step reaction route that can convert 1-Butene (CH2CHCH2CH3) into a compound that is more soluble in water. Use mechanisms to aid your answer (HINT: one of the steps involves nucleophilic substitution)

CH2CHCH2CH3 + HBr (room temp) --> CH3CH(Br)CH2CH3CH3CH(Br)CH2CH3 + NaOH (reflux) --> CH3CH(OH)CH2CH3Mechanism can be done on lesson spaceFinal product is more water soluble as the OH group will enable it to form hydrogen bonds with water

SN

Related Chemistry A Level answers

All answers ▸

What is the trend in electronegativity of group 7?


In terms of bonding, state the order of boiling point of propane, ethanol and ethanal and why.


How can I use an infrared spectrum with a mass spectrum to identify an unknown compound?


Elements in the Periodic Table often show periodic trends. Describe and explain the periodic trend in atomic radius and electronegativity from Na to Cl.